C13H16Cl2N2O2 — CID 119405924
N-(3-aminopropyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 119405924) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-(3-aminopropyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119405924 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(3-aminopropyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCCN)oc2c(Cl)cccc12.Cl |
| InChI | InChI=1S/C13H15ClN2O2.ClH/c1-8-9-4-2-5-10(14)12(9)18-11(8)13(17)16-7-3-6-15;/h2,4-5H,3,6-7,15H2,1H3,(H,16,17);1H |
| InChIKey | JMOWBDOOJDZFKH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|