C17H22Cl2N2O2 — CID 119556193
7-chloro-3-methyl-N-(2-piperidin-3-ylethyl)-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 119556193) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 7-chloro-3-methyl-N-(2-piperidin-3-ylethyl)-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | 7-chloro-3-methyl-N-(2-piperidin-3-ylethyl)-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119556193 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 7-chloro-3-methyl-N-(2-piperidin-3-ylethyl)-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCC2CCCNC2)oc2c(Cl)cccc12.Cl |
| InChI | InChI=1S/C17H21ClN2O2.ClH/c1-11-13-5-2-6-14(18)16(13)22-15(11)17(21)20-9-7-12-4-3-8-19-10-12;/h2,5-6,12,19H,3-4,7-10H2,1H3,(H,20,21);1H |
| InChIKey | JREQNUNALCNYBS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |