C12H17ClN4O3S — CID 119407322
N-(3-aminopropyl)-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride (PubChem CID 119407322) has the molecular formula C12H17ClN4O3S and a molecular weight of 332.81 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119407322 |
| Molecular Formula | C12H17ClN4O3S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(3-aminopropyl)-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)c1nc(C(=O)NCCCN)c2ccccn12.Cl |
| InChI | InChI=1S/C12H16N4O3S.ClH/c1-20(18,19)12-15-10(11(17)14-7-4-6-13)9-5-2-3-8-16(9)12;/h2-3,5,8H,4,6-7,13H2,1H3,(H,14,17);1H |
| InChIKey | CUDJLPRSXSCGAH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|