C13H19ClN4O3S — CID 119432312
N-[3-(methylamino)propyl]-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride (PubChem CID 119432312) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119432312 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[3-(methylamino)propyl]-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1nc(S(C)(=O)=O)n2ccccc12.Cl |
| InChI | InChI=1S/C13H18N4O3S.ClH/c1-14-7-5-8-15-12(18)11-10-6-3-4-9-17(10)13(16-11)21(2,19)20;/h3-4,6,9,14H,5,7-8H2,1-2H3,(H,15,18);1H |
| InChIKey | BWBXFULJNOHFFA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|