C15H23BrN2O3S — CID 119407481
N-(3-aminopropyl)-2-[(3-bromophenyl)methyl]-4-methylsulfonylbutanamide (PubChem CID 119407481) has the molecular formula C15H23BrN2O3S and a molecular weight of 391.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[(3-bromophenyl)methyl]-4-methylsulfonylbutanamide.
| Compound Name | N-(3-aminopropyl)-2-[(3-bromophenyl)methyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 119407481 |
| Molecular Formula | C15H23BrN2O3S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-(3-aminopropyl)-2-[(3-bromophenyl)methyl]-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(Cc1cccc(Br)c1)C(=O)NCCCN |
| InChI | InChI=1S/C15H23BrN2O3S/c1-22(20,21)9-6-13(15(19)18-8-3-7-17)10-12-4-2-5-14(16)11-12/h2,4-5,11,13H,3,6-10,17H2,1H3,(H,18,19) |
| InChIKey | PUYROEXLNDSFLO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|