C15H24BrClN2O — CID 119433677
2-[(3-bromophenyl)methyl]-N-[3-(methylamino)propyl]butanamide;hydrochloride (PubChem CID 119433677) has the molecular formula C15H24BrClN2O and a molecular weight of 363.73 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-N-[3-(methylamino)propyl]butanamide;hydrochloride.
| Compound Name | 2-[(3-bromophenyl)methyl]-N-[3-(methylamino)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119433677 |
| Molecular Formula | C15H24BrClN2O |
| Molecular Weight | 363.73 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-N-[3-(methylamino)propyl]butanamide;hydrochloride |
| SMILES | CCC(Cc1cccc(Br)c1)C(=O)NCCCNC.Cl |
| InChI | InChI=1S/C15H23BrN2O.ClH/c1-3-13(15(19)18-9-5-8-17-2)10-12-6-4-7-14(16)11-12;/h4,6-7,11,13,17H,3,5,8-10H2,1-2H3,(H,18,19);1H |
| InChIKey | YPDVNEUCLOYWGN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|