C14H21N3O4S — CID 119407704
N-(3-aminopropyl)-2-morpholin-4-ylsulfonylbenzamide (PubChem CID 119407704) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(3-aminopropyl)-2-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 119407704 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(3-aminopropyl)-2-morpholin-4-ylsulfonylbenzamide |
| SMILES | NCCCNC(=O)c1ccccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H21N3O4S/c15-6-3-7-16-14(18)12-4-1-2-5-13(12)22(19,20)17-8-10-21-11-9-17/h1-2,4-5H,3,6-11,15H2,(H,16,18) |
| InChIKey | NZFJCERUQXIJIZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|