C11H15N3O4S — CID 71258107
2-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 71258107) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | 2-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 71258107 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | NNC(=O)c1ccccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H15N3O4S/c12-13-11(15)9-3-1-2-4-10(9)19(16,17)14-5-7-18-8-6-14/h1-4H,5-8,12H2,(H,13,15) |
| InChIKey | HKZCTGLTIWIBCC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|