C21H26N2O4S — CID 39888559
N-(4-tert-butylphenyl)-2-morpholin-4-ylsulfonylbenzamide (PubChem CID 39888559) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(4-tert-butylphenyl)-2-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 39888559 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccccc2S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N2O4S/c1-21(2,3)16-8-10-17(11-9-16)22-20(24)18-6-4-5-7-19(18)28(25,26)23-12-14-27-15-13-23/h4-11H,12-15H2,1-3H3,(H,22,24) |
| InChIKey | UEPMURMZVVSVIG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |