C23H20N2O5S — CID 60553696
N-dibenzofuran-3-yl-2-morpholin-4-ylsulfonylbenzamide (PubChem CID 60553696) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-dibenzofuran-3-yl-2-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60553696 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-dibenzofuran-3-yl-2-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)c1ccccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H20N2O5S/c26-23(19-6-2-4-8-22(19)31(27,28)25-11-13-29-14-12-25)24-16-9-10-18-17-5-1-3-7-20(17)30-21(18)15-16/h1-10,15H,11-14H2,(H,24,26) |
| InChIKey | CMZONOULGPURFE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |