C19H28N4O — CID 119407891
N-(3-aminopropyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide (PubChem CID 119407891) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide.
| Compound Name | N-(3-aminopropyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 119407891 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N-(3-aminopropyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide |
| SMILES | Cc1ccc(Cn2nc(C)c(CCC(=O)NCCCN)c2C)cc1 |
| InChI | InChI=1S/C19H28N4O/c1-14-5-7-17(8-6-14)13-23-16(3)18(15(2)22-23)9-10-19(24)21-12-4-11-20/h5-8H,4,9-13,20H2,1-3H3,(H,21,24) |
| InChIKey | JUFFKXOWNXLVLW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|