C22H27ClN4O — CID 119422553
N-(2-aminophenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide;hydrochloride (PubChem CID 119422553) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119422553 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-(2-aminophenyl)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]propanamide;hydrochloride |
| SMILES | Cc1ccc(Cn2nc(C)c(CCC(=O)Nc3ccccc3N)c2C)cc1.Cl |
| InChI | InChI=1S/C22H26N4O.ClH/c1-15-8-10-18(11-9-15)14-26-17(3)19(16(2)25-26)12-13-22(27)24-21-7-5-4-6-20(21)23;/h4-11H,12-14,23H2,1-3H3,(H,24,27);1H |
| InChIKey | MVMHJRDGFZQDRN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|