C14H17Cl2N3O2 — CID 119409022
N-(3-aminopropyl)-1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 119409022) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-aminopropyl)-1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119409022 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(3-aminopropyl)-1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | NCCCNC(=O)C1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-10-5-11(16)7-12(6-10)19-8-9(4-13(19)20)14(21)18-3-1-2-17/h5-7,9H,1-4,8,17H2,(H,18,21) |
| InChIKey | UBWPVKUMDRRKKG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|