C17H25BrN4O2 — CID 119409965
1-[1-[(3R)-3-aminopyrrolidin-1-yl]-1-oxopentan-2-yl]-3-[(4-bromophenyl)methyl]urea (PubChem CID 119409965) has the molecular formula C17H25BrN4O2 and a molecular weight of 397.32 g/mol. Its IUPAC name is 1-[1-[(3R)-3-aminopyrrolidin-1-yl]-1-oxopentan-2-yl]-3-[(4-bromophenyl)methyl]urea.
| Compound Name | 1-[1-[(3R)-3-aminopyrrolidin-1-yl]-1-oxopentan-2-yl]-3-[(4-bromophenyl)methyl]urea |
|---|---|
| PubChem CID | 119409965 |
| Molecular Formula | C17H25BrN4O2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-[1-[(3R)-3-aminopyrrolidin-1-yl]-1-oxopentan-2-yl]-3-[(4-bromophenyl)methyl]urea |
| SMILES | CCCC(NC(=O)NCc1ccc(Br)cc1)C(=O)N1CC[C@@H](N)C1 |
| InChI | InChI=1S/C17H25BrN4O2/c1-2-3-15(16(23)22-9-8-14(19)11-22)21-17(24)20-10-12-4-6-13(18)7-5-12/h4-7,14-15H,2-3,8-11,19H2,1H3,(H2,20,21,24)/t14-,15?/m1/s1 |
| InChIKey | WOGYSVXOELMTQD-GICMACPYSA-N |
| XLogP | 1.98 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |