C17H27BrN4O2 — CID 119430294
2-[(4-bromophenyl)methylcarbamoylamino]-N-[3-(methylamino)propyl]pentanamide (PubChem CID 119430294) has the molecular formula C17H27BrN4O2 and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylcarbamoylamino]-N-[3-(methylamino)propyl]pentanamide.
| Compound Name | 2-[(4-bromophenyl)methylcarbamoylamino]-N-[3-(methylamino)propyl]pentanamide |
|---|---|
| PubChem CID | 119430294 |
| Molecular Formula | C17H27BrN4O2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[(4-bromophenyl)methylcarbamoylamino]-N-[3-(methylamino)propyl]pentanamide |
| SMILES | CCCC(NC(=O)NCc1ccc(Br)cc1)C(=O)NCCCNC |
| InChI | InChI=1S/C17H27BrN4O2/c1-3-5-15(16(23)20-11-4-10-19-2)22-17(24)21-12-13-6-8-14(18)9-7-13/h6-9,15,19H,3-5,10-12H2,1-2H3,(H,20,23)(H2,21,22,24) |
| InChIKey | WPFGVXVJRZWFKM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|