C18H31ClN4O2 — CID 119501003
4-methyl-N-[2-(methylamino)ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]pentanamide;hydrochloride (PubChem CID 119501003) has the molecular formula C18H31ClN4O2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 4-methyl-N-[2-(methylamino)ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]pentanamide;hydrochloride.
| Compound Name | 4-methyl-N-[2-(methylamino)ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119501003 |
| Molecular Formula | C18H31ClN4O2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-methyl-N-[2-(methylamino)ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]pentanamide;hydrochloride |
| SMILES | CNCCNC(=O)C(CC(C)C)NC(=O)NCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C18H30N4O2.ClH/c1-13(2)11-16(17(23)20-10-9-19-4)22-18(24)21-12-15-7-5-14(3)6-8-15;/h5-8,13,16,19H,9-12H2,1-4H3,(H,20,23)(H2,21,22,24);1H |
| InChIKey | HVKIMHHZBWCXFR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|