C21H33ClN4O2 — CID 120657725
1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-methyl-1-oxopentan-2-yl]-3-[(4-methylphenyl)methyl]urea;hydrochloride (PubChem CID 120657725) has the molecular formula C21H33ClN4O2 and a molecular weight of 408.97 g/mol. Its IUPAC name is 1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-methyl-1-oxopentan-2-yl]-3-[(4-methylphenyl)methyl]urea;hydrochloride.
| Compound Name | 1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-methyl-1-oxopentan-2-yl]-3-[(4-methylphenyl)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 120657725 |
| Molecular Formula | C21H33ClN4O2 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-methyl-1-oxopentan-2-yl]-3-[(4-methylphenyl)methyl]urea;hydrochloride |
| SMILES | Cc1ccc(CNC(=O)NC(CC(C)C)C(=O)N2C[C@H]3CNC[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C21H32N4O2.ClH/c1-14(2)8-19(20(26)25-12-17-10-22-11-18(17)13-25)24-21(27)23-9-16-6-4-15(3)5-7-16;/h4-7,14,17-19,22H,8-13H2,1-3H3,(H2,23,24,27);1H/t17-,18+,19?; |
| InChIKey | XVRHGEXFRVOPII-FMJRHHGGSA-N |
| XLogP | 2.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |