C16H30ClN3O2 — CID 120655829
N-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methyl-1-oxobutan-2-yl]-3-methylbutanamide;hydrochloride (PubChem CID 120655829) has the molecular formula C16H30ClN3O2 and a molecular weight of 331.89 g/mol. Its IUPAC name is N-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methyl-1-oxobutan-2-yl]-3-methylbutanamide;hydrochloride.
| Compound Name | N-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methyl-1-oxobutan-2-yl]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120655829 |
| Molecular Formula | C16H30ClN3O2 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-methyl-1-oxobutan-2-yl]-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)CC(=O)NC(C(=O)N1C[C@H]2CNC[C@H]2C1)C(C)C.Cl |
| InChI | InChI=1S/C16H29N3O2.ClH/c1-10(2)5-14(20)18-15(11(3)4)16(21)19-8-12-6-17-7-13(12)9-19;/h10-13,15,17H,5-9H2,1-4H3,(H,18,20);1H/t12-,13+,15?; |
| InChIKey | ILWCTJSPEMLTEM-HLRVCSOFSA-N |
| XLogP | 1.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |