C23H30N4O3 — CID 46585355
N-methyl-3-[[4-methyl-2-[(4-methylphenyl)methylcarbamoylamino]pentanoyl]amino]benzamide (PubChem CID 46585355) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-methyl-3-[[4-methyl-2-[(4-methylphenyl)methylcarbamoylamino]pentanoyl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-methyl-2-[(4-methylphenyl)methylcarbamoylamino]pentanoyl]amino]benzamide |
|---|---|
| PubChem CID | 46585355 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-methyl-3-[[4-methyl-2-[(4-methylphenyl)methylcarbamoylamino]pentanoyl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C(CC(C)C)NC(=O)NCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-15(2)12-20(27-23(30)25-14-17-10-8-16(3)9-11-17)22(29)26-19-7-5-6-18(13-19)21(28)24-4/h5-11,13,15,20H,12,14H2,1-4H3,(H,24,28)(H,26,29)(H2,25,27,30) |
| InChIKey | SNPOEZLIRWJMKV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |