C16H22N4S — CID 11941077
N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 11941077) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11941077 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(NN=C3[C@@H](C)CCC[C@@H]3C)c2c1C |
| InChI | InChI=1S/C16H22N4S/c1-9-6-5-7-10(2)14(9)19-20-15-13-11(3)12(4)21-16(13)18-8-17-15/h8-10H,5-7H2,1-4H3,(H,17,18,20)/t9-,10-/m0/s1 |
| InChIKey | DLKGVVBUQBLUOT-UWVGGRQHSA-N |
| XLogP | 4.53 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|