C20H23N5S — CID 9409213
N-[(1-benzylpiperidin-4-ylidene)amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 9409213) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9409213 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(NN=C3CCN(Cc4ccccc4)CC3)c2c1C |
| InChI | InChI=1S/C20H23N5S/c1-14-15(2)26-20-18(14)19(21-13-22-20)24-23-17-8-10-25(11-9-17)12-16-6-4-3-5-7-16/h3-7,13H,8-12H2,1-2H3,(H,21,22,24) |
| InChIKey | HSRCIDKSJIWHHN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|