C12H16ClN3O3S — CID 119411515
[(3R)-3-aminopyrrolidin-1-yl]-(5-methylsulfanyl-2-nitrophenyl)methanone;hydrochloride (PubChem CID 119411515) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(5-methylsulfanyl-2-nitrophenyl)methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(5-methylsulfanyl-2-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119411515 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(5-methylsulfanyl-2-nitrophenyl)methanone;hydrochloride |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)N2CC[C@@H](N)C2)c1.Cl |
| InChI | InChI=1S/C12H15N3O3S.ClH/c1-19-9-2-3-11(15(17)18)10(6-9)12(16)14-5-4-8(13)7-14;/h2-3,6,8H,4-5,7,13H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | GLHOUWGEZUWVJU-DDWIOCJRSA-N |
| XLogP | 1.91 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|