C20H22N2O2 — CID 119411621
1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-phenylphenyl)butane-1,4-dione (PubChem CID 119411621) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-phenylphenyl)butane-1,4-dione.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-phenylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 119411621 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-phenylphenyl)butane-1,4-dione |
| SMILES | N[C@@H]1CCN(C(=O)CCC(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H22N2O2/c21-18-12-13-22(14-18)20(24)11-10-19(23)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-9,18H,10-14,21H2/t18-/m1/s1 |
| InChIKey | ZRHUBQCCPGRROU-GOSISDBHSA-N |
| XLogP | 2.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |