C13H17BrN2O3S — CID 119411771
1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(3-bromophenyl)methylsulfonyl]ethanone (PubChem CID 119411771) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(3-bromophenyl)methylsulfonyl]ethanone.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(3-bromophenyl)methylsulfonyl]ethanone |
|---|---|
| PubChem CID | 119411771 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[(3-bromophenyl)methylsulfonyl]ethanone |
| SMILES | N[C@@H]1CCN(C(=O)CS(=O)(=O)Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C13H17BrN2O3S/c14-11-3-1-2-10(6-11)8-20(18,19)9-13(17)16-5-4-12(15)7-16/h1-3,6,12H,4-5,7-9,15H2/t12-/m1/s1 |
| InChIKey | NGAXSLWJZUZTMO-GFCCVEGCSA-N |
| XLogP | 0.92 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |