C21H27FN3O4S+ — CID 11941180
(1R,2R,6R,7R,11R)-5-[(4-fluorophenyl)methyl]-11-hydroxy-3-(2-morpholin-4-ium-4-ylethyl)-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one (PubChem CID 11941180) has the molecular formula C21H27FN3O4S+ and a molecular weight of 436.53 g/mol. Its IUPAC name is (1R,2R,6R,7R,11R)-5-[(4-fluorophenyl)methyl]-11-hydroxy-3-(2-morpholin-4-ium-4-ylethyl)-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one.
| Compound Name | (1R,2R,6R,7R,11R)-5-[(4-fluorophenyl)methyl]-11-hydroxy-3-(2-morpholin-4-ium-4-ylethyl)-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
|---|---|
| PubChem CID | 11941180 |
| Molecular Formula | C21H27FN3O4S+ |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (1R,2R,6R,7R,11R)-5-[(4-fluorophenyl)methyl]-11-hydroxy-3-(2-morpholin-4-ium-4-ylethyl)-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
| SMILES | O=C1O[C@@H]2[C@H]3[C@@H]([C@H]1C[C@H]2O)N(CC[NH+]1CCOCC1)C(=S)N3Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O4S/c22-14-3-1-13(2-4-14)12-25-18-17(15-11-16(26)19(18)29-20(15)27)24(21(25)30)6-5-23-7-9-28-10-8-23/h1-4,15-19,26H,5-12H2/p+1/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | RQNGHAPPRRRQQJ-NNIGNNQHSA-O |
| XLogP | -0.81 |
| TPSA | 66.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|