C19H26FN3O3S — CID 40781661
(3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(2-methylpropyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide (PubChem CID 40781661) has the molecular formula C19H26FN3O3S and a molecular weight of 395.50 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(2-methylpropyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(2-methylpropyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40781661 |
| Molecular Formula | C19H26FN3O3S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-1-[(4-fluorophenyl)methyl]-6,7-dihydroxy-3-(2-methylpropyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydrobenzimidazole-4-carboxamide |
| SMILES | CC(C)CN1C(=S)N(Cc2ccc(F)cc2)[C@H]2[C@@H](O)[C@H](O)C[C@@H](C(N)=O)[C@H]21 |
| InChI | InChI=1S/C19H26FN3O3S/c1-10(2)8-22-15-13(18(21)26)7-14(24)17(25)16(15)23(19(22)27)9-11-3-5-12(20)6-4-11/h3-6,10,13-17,24-25H,7-9H2,1-2H3,(H2,21,26)/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | LWBYOPAUICBXBR-HHARLNAUSA-N |
| XLogP | 0.85 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|