C14H21N3O3S — CID 119414359
N-[2-(1,4-diazepane-1-carbonyl)-4-methylphenyl]methanesulfonamide (PubChem CID 119414359) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[2-(1,4-diazepane-1-carbonyl)-4-methylphenyl]methanesulfonamide.
| Compound Name | N-[2-(1,4-diazepane-1-carbonyl)-4-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 119414359 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[2-(1,4-diazepane-1-carbonyl)-4-methylphenyl]methanesulfonamide |
| SMILES | Cc1ccc(NS(C)(=O)=O)c(C(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C14H21N3O3S/c1-11-4-5-13(16-21(2,19)20)12(10-11)14(18)17-8-3-6-15-7-9-17/h4-5,10,15-16H,3,6-9H2,1-2H3 |
| InChIKey | BVVSHKPMIOMXEG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |