C17H25N5O — CID 144775289
1,4-diazepan-1-yl-[5-methyl-2-(triazol-2-yl)phenyl]methanone;ethane (PubChem CID 144775289) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[5-methyl-2-(triazol-2-yl)phenyl]methanone;ethane.
| Compound Name | 1,4-diazepan-1-yl-[5-methyl-2-(triazol-2-yl)phenyl]methanone;ethane |
|---|---|
| PubChem CID | 144775289 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1,4-diazepan-1-yl-[5-methyl-2-(triazol-2-yl)phenyl]methanone;ethane |
| SMILES | CC.Cc1ccc(-n2nccn2)c(C(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C15H19N5O.C2H6/c1-12-3-4-14(20-17-6-7-18-20)13(11-12)15(21)19-9-2-5-16-8-10-19;1-2/h3-4,6-7,11,16H,2,5,8-10H2,1H3;1-2H3 |
| InChIKey | HEYZHRXDIDTRMF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |