C16H20N4O2 — CID 70226915
[(3R)-3-(hydroxymethyl)piperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone (PubChem CID 70226915) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is [(3R)-3-(hydroxymethyl)piperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(3R)-3-(hydroxymethyl)piperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 70226915 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(3R)-3-(hydroxymethyl)piperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone |
| SMILES | Cc1ccc(-n2nccn2)c(C(=O)N2CCC[C@@H](CO)C2)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-12-4-5-15(20-17-6-7-18-20)14(9-12)16(22)19-8-2-3-13(10-19)11-21/h4-7,9,13,21H,2-3,8,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | DJCUTWMPXNTWRJ-CYBMUJFWSA-N |
| XLogP | 1.42 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |