C14H18FN3O2 — CID 119414587
N-[3-(1,4-diazepane-1-carbonyl)-4-fluorophenyl]acetamide (PubChem CID 119414587) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is N-[3-(1,4-diazepane-1-carbonyl)-4-fluorophenyl]acetamide.
| Compound Name | N-[3-(1,4-diazepane-1-carbonyl)-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 119414587 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[3-(1,4-diazepane-1-carbonyl)-4-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(C(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C14H18FN3O2/c1-10(19)17-11-3-4-13(15)12(9-11)14(20)18-7-2-5-16-6-8-18/h3-4,9,16H,2,5-8H2,1H3,(H,17,19) |
| InChIKey | QFVSVNRBTGRMAE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |