C18H21N3O3 — CID 119418147
N-[2-(1,4-diazepane-1-carbonyl)phenyl]-N-methylfuran-2-carboxamide (PubChem CID 119418147) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[2-(1,4-diazepane-1-carbonyl)phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-(1,4-diazepane-1-carbonyl)phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119418147 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[2-(1,4-diazepane-1-carbonyl)phenyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(C(=O)c1ccco1)c1ccccc1C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C18H21N3O3/c1-20(18(23)16-8-4-13-24-16)15-7-3-2-6-14(15)17(22)21-11-5-9-19-10-12-21/h2-4,6-8,13,19H,5,9-12H2,1H3 |
| InChIKey | LZHNOHAYECTWEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |