C20H26ClN3O3 — CID 119419212
N-(3-amino-4-methoxyphenyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride (PubChem CID 119419212) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119419212 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride |
| SMILES | CCCC(NC(=O)Cc1ccccc1)C(=O)Nc1ccc(OC)c(N)c1.Cl |
| InChI | InChI=1S/C20H25N3O3.ClH/c1-3-7-17(23-19(24)12-14-8-5-4-6-9-14)20(25)22-15-10-11-18(26-2)16(21)13-15;/h4-6,8-11,13,17H,3,7,12,21H2,1-2H3,(H,22,25)(H,23,24);1H |
| InChIKey | VHXZLKCQSWDBHW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|