C18H23ClN4O2 — CID 119515245
N-(6-amino-3-pyridinyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride (PubChem CID 119515245) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119515245 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-[(2-phenylacetyl)amino]pentanamide;hydrochloride |
| SMILES | CCCC(NC(=O)Cc1ccccc1)C(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C18H22N4O2.ClH/c1-2-6-15(18(24)21-14-9-10-16(19)20-12-14)22-17(23)11-13-7-4-3-5-8-13;/h3-5,7-10,12,15H,2,6,11H2,1H3,(H2,19,20)(H,21,24)(H,22,23);1H |
| InChIKey | ZFNSAEICBFGOFF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |