C17H22ClN3OS — CID 119515772
N-(6-amino-3-pyridinyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride (PubChem CID 119515772) has the molecular formula C17H22ClN3OS and a molecular weight of 351.90 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119515772 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)C(SCc1ccccc1)C(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C17H21N3OS.ClH/c1-12(2)16(22-11-13-6-4-3-5-7-13)17(21)20-14-8-9-15(18)19-10-14;/h3-10,12,16H,11H2,1-2H3,(H2,18,19)(H,20,21);1H |
| InChIKey | YJWILNAFTOZZLY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |