C16H27ClN2OS — CID 119497245
N-(3-aminobutyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride (PubChem CID 119497245) has the molecular formula C16H27ClN2OS and a molecular weight of 330.93 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119497245 |
| Molecular Formula | C16H27ClN2OS |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-(3-aminobutyl)-2-benzylsulfanyl-3-methylbutanamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)C(SCc1ccccc1)C(C)C.Cl |
| InChI | InChI=1S/C16H26N2OS.ClH/c1-12(2)15(16(19)18-10-9-13(3)17)20-11-14-7-5-4-6-8-14;/h4-8,12-13,15H,9-11,17H2,1-3H3,(H,18,19);1H |
| InChIKey | VAHJTIDZSHCSEJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |