C20H26N2OS — CID 119548621
N-[2-(4-aminophenyl)ethyl]-2-benzylsulfanyl-3-methylbutanamide (PubChem CID 119548621) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-benzylsulfanyl-3-methylbutanamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-benzylsulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 119548621 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-benzylsulfanyl-3-methylbutanamide |
| SMILES | CC(C)C(SCc1ccccc1)C(=O)NCCc1ccc(N)cc1 |
| InChI | InChI=1S/C20H26N2OS/c1-15(2)19(24-14-17-6-4-3-5-7-17)20(23)22-13-12-16-8-10-18(21)11-9-16/h3-11,15,19H,12-14,21H2,1-2H3,(H,22,23) |
| InChIKey | LPHXAOXXZNOKCQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|