C16H20N4O3 — CID 119419525
N-(3-amino-4-methoxyphenyl)-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 119419525) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 119419525 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCc2nc(C3CC3)no2)cc1N |
| InChI | InChI=1S/C16H20N4O3/c1-22-13-8-7-11(9-12(13)17)18-14(21)3-2-4-15-19-16(20-23-15)10-5-6-10/h7-10H,2-6,17H2,1H3,(H,18,21) |
| InChIKey | HMNZCLQPVIDQET-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|