C14H17ClF3N3O3 — CID 119420226
N-(3-amino-4-methoxyphenyl)-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119420226) has the molecular formula C14H17ClF3N3O3 and a molecular weight of 367.76 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119420226 |
| Molecular Formula | C14H17ClF3N3O3 |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2CC(=O)N(CC(F)(F)F)C2)cc1N.Cl |
| InChI | InChI=1S/C14H16F3N3O3.ClH/c1-23-11-3-2-9(5-10(11)18)19-13(22)8-4-12(21)20(6-8)7-14(15,16)17;/h2-3,5,8H,4,6-7,18H2,1H3,(H,19,22);1H |
| InChIKey | IXFLKWYBCCODDU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|