C23H27ClN4O2 — CID 119424422
1-benzyl-3-(4-methoxyphenyl)-N-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119424422) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 1-benzyl-3-(4-methoxyphenyl)-N-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-benzyl-3-(4-methoxyphenyl)-N-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119424422 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-benzyl-3-(4-methoxyphenyl)-N-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2C(=O)NC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C23H26N4O2.ClH/c1-29-20-11-9-18(10-12-20)22-21(23(28)25-19-8-5-13-24-14-19)16-27(26-22)15-17-6-3-2-4-7-17;/h2-4,6-7,9-12,16,19,24H,5,8,13-15H2,1H3,(H,25,28);1H |
| InChIKey | CSBAWMBGQZBRBS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |