C12H19BrClN3O — CID 119424531
4-bromo-1-ethyl-N-piperidin-3-ylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119424531) has the molecular formula C12H19BrClN3O and a molecular weight of 336.66 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-piperidin-3-ylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-bromo-1-ethyl-N-piperidin-3-ylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119424531 |
| Molecular Formula | C12H19BrClN3O |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-bromo-1-ethyl-N-piperidin-3-ylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CCn1cc(Br)cc1C(=O)NC1CCCNC1.Cl |
| InChI | InChI=1S/C12H18BrN3O.ClH/c1-2-16-8-9(13)6-11(16)12(17)15-10-4-3-5-14-7-10;/h6,8,10,14H,2-5,7H2,1H3,(H,15,17);1H |
| InChIKey | YQYOJPSOSGSOBF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |