C14H23BrClN3O — CID 119473923
4-bromo-1-ethyl-N-(1-piperidin-3-ylethyl)pyrrole-2-carboxamide;hydrochloride (PubChem CID 119473923) has the molecular formula C14H23BrClN3O and a molecular weight of 364.72 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(1-piperidin-3-ylethyl)pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-bromo-1-ethyl-N-(1-piperidin-3-ylethyl)pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119473923 |
| Molecular Formula | C14H23BrClN3O |
| Molecular Weight | 364.72 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-bromo-1-ethyl-N-(1-piperidin-3-ylethyl)pyrrole-2-carboxamide;hydrochloride |
| SMILES | CCn1cc(Br)cc1C(=O)NC(C)C1CCCNC1.Cl |
| InChI | InChI=1S/C14H22BrN3O.ClH/c1-3-18-9-12(15)7-13(18)14(19)17-10(2)11-5-4-6-16-8-11;/h7,9-11,16H,3-6,8H2,1-2H3,(H,17,19);1H |
| InChIKey | PZWSSGQZSPOBLH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |