C19H22ClN3O3 — CID 119425394
3-[(2-oxo-3H-indol-1-yl)methyl]-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride (PubChem CID 119425394) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-[(2-oxo-3H-indol-1-yl)methyl]-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride.
| Compound Name | 3-[(2-oxo-3H-indol-1-yl)methyl]-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119425394 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-[(2-oxo-3H-indol-1-yl)methyl]-N-piperidin-3-ylfuran-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)c1occc1CN1C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C19H21N3O3.ClH/c23-17-10-13-4-1-2-6-16(13)22(17)12-14-7-9-25-18(14)19(24)21-15-5-3-8-20-11-15;/h1-2,4,6-7,9,15,20H,3,5,8,10-12H2,(H,21,24);1H |
| InChIKey | USKCNSWKJKXTNC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |