C19H21N3O3 — CID 125146446
N-methyl-3-[(2-oxo-3H-indol-1-yl)methyl]-N-[(3S)-pyrrolidin-3-yl]furan-2-carboxamide (PubChem CID 125146446) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-methyl-3-[(2-oxo-3H-indol-1-yl)methyl]-N-[(3S)-pyrrolidin-3-yl]furan-2-carboxamide.
| Compound Name | N-methyl-3-[(2-oxo-3H-indol-1-yl)methyl]-N-[(3S)-pyrrolidin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 125146446 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-methyl-3-[(2-oxo-3H-indol-1-yl)methyl]-N-[(3S)-pyrrolidin-3-yl]furan-2-carboxamide |
| SMILES | CN(C(=O)c1occc1CN1C(=O)Cc2ccccc21)[C@H]1CCNC1 |
| InChI | InChI=1S/C19H21N3O3/c1-21(15-6-8-20-11-15)19(24)18-14(7-9-25-18)12-22-16-5-3-2-4-13(16)10-17(22)23/h2-5,7,9,15,20H,6,8,10-12H2,1H3/t15-/m0/s1 |
| InChIKey | JUFGUJFEOIYJKQ-HNNXBMFYSA-N |
| XLogP | 1.80 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |