C19H20N2O5 — CID 154858387
1-[[2-[2-(hydroxymethyl)morpholine-4-carbonyl]furan-3-yl]methyl]-3H-indol-2-one (PubChem CID 154858387) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-[[2-[2-(hydroxymethyl)morpholine-4-carbonyl]furan-3-yl]methyl]-3H-indol-2-one.
| Compound Name | 1-[[2-[2-(hydroxymethyl)morpholine-4-carbonyl]furan-3-yl]methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 154858387 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[[2-[2-(hydroxymethyl)morpholine-4-carbonyl]furan-3-yl]methyl]-3H-indol-2-one |
| SMILES | O=C(c1occc1CN1C(=O)Cc2ccccc21)N1CCOC(CO)C1 |
| InChI | InChI=1S/C19H20N2O5/c22-12-15-11-20(6-8-25-15)19(24)18-14(5-7-26-18)10-21-16-4-2-1-3-13(16)9-17(21)23/h1-5,7,15,22H,6,8-12H2 |
| InChIKey | PAUUWEMFVLCVLM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |