C26H23NO7S — CID 1194284
ethyl 4-(4-methoxyphenyl)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 1194284) has the molecular formula C26H23NO7S and a molecular weight of 493.54 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methoxyphenyl)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1194284 |
| Molecular Formula | C26H23NO7S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)COc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H23NO7S/c1-4-32-26(30)24-20(16-5-7-17(31-3)8-6-16)14-35-25(24)27-22(28)13-33-18-9-10-19-15(2)11-23(29)34-21(19)12-18/h5-12,14H,4,13H2,1-3H3,(H,27,28) |
| InChIKey | STPFLVPNXIFYAO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|