C18H20FN3O3S — CID 119428717
4-[(2-fluorophenyl)sulfamoyl]-N-piperidin-3-ylbenzamide (PubChem CID 119428717) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)sulfamoyl]-N-piperidin-3-ylbenzamide.
| Compound Name | 4-[(2-fluorophenyl)sulfamoyl]-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119428717 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-[(2-fluorophenyl)sulfamoyl]-N-piperidin-3-ylbenzamide |
| SMILES | O=C(NC1CCCNC1)c1ccc(S(=O)(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H20FN3O3S/c19-16-5-1-2-6-17(16)22-26(24,25)15-9-7-13(8-10-15)18(23)21-14-4-3-11-20-12-14/h1-2,5-10,14,20,22H,3-4,11-12H2,(H,21,23) |
| InChIKey | XULYSWICFPPOIW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |