C18H20ClF2N3O3S — CID 119427476
3-[(3,4-difluorophenyl)sulfonylamino]-N-piperidin-3-ylbenzamide;hydrochloride (PubChem CID 119427476) has the molecular formula C18H20ClF2N3O3S and a molecular weight of 431.89 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-piperidin-3-ylbenzamide;hydrochloride.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-piperidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119427476 |
| Molecular Formula | C18H20ClF2N3O3S |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-piperidin-3-ylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)c1cccc(NS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C18H19F2N3O3S.ClH/c19-16-7-6-15(10-17(16)20)27(25,26)23-13-4-1-3-12(9-13)18(24)22-14-5-2-8-21-11-14;/h1,3-4,6-7,9-10,14,21,23H,2,5,8,11H2,(H,22,24);1H |
| InChIKey | MMFCARBKBLTTIS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |