C18H19F2N3O3S — CID 119513016
3-[(3,4-difluorophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 119513016) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119513016 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCN1)c1cccc(NS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C18H19F2N3O3S/c19-16-7-6-15(10-17(16)20)27(25,26)23-13-4-1-3-12(9-13)18(24)22-11-14-5-2-8-21-14/h1,3-4,6-7,9-10,14,21,23H,2,5,8,11H2,(H,22,24) |
| InChIKey | HACMFHRZZQNITP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |