C18H21Cl2N3O3S — CID 119513853
3-[(3-chlorophenyl)sulfamoyl]-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride (PubChem CID 119513853) has the molecular formula C18H21Cl2N3O3S and a molecular weight of 430.36 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfamoyl]-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride.
| Compound Name | 3-[(3-chlorophenyl)sulfamoyl]-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119513853 |
| Molecular Formula | C18H21Cl2N3O3S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfamoyl]-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCN1)c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H20ClN3O3S.ClH/c19-14-5-2-6-15(11-14)22-26(24,25)17-8-1-4-13(10-17)18(23)21-12-16-7-3-9-20-16;/h1-2,4-6,8,10-11,16,20,22H,3,7,9,12H2,(H,21,23);1H |
| InChIKey | DLUFAGIULKCICJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |