C14H19Cl3N2O — CID 119429856
2-(2,4-dichlorophenyl)-N-[3-(methylamino)propyl]cyclopropane-1-carboxamide;hydrochloride (PubChem CID 119429856) has the molecular formula C14H19Cl3N2O and a molecular weight of 337.68 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[3-(methylamino)propyl]cyclopropane-1-carboxamide;hydrochloride.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[3-(methylamino)propyl]cyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119429856 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[3-(methylamino)propyl]cyclopropane-1-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)C1CC1c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H18Cl2N2O.ClH/c1-17-5-2-6-18-14(19)12-8-11(12)10-4-3-9(15)7-13(10)16;/h3-4,7,11-12,17H,2,5-6,8H2,1H3,(H,18,19);1H |
| InChIKey | RMAZOQOZIHYNTE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|